C24H44 — CID 173281367
1-[(E)-but-2-enyl]-4-[4-(4-butylcyclohexyl)butyl]cyclohexane (PubChem CID 173281367) has the molecular formula C24H44 and a molecular weight of 332.62 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-4-[4-(4-butylcyclohexyl)butyl]cyclohexane.
| Compound Name | 1-[(E)-but-2-enyl]-4-[4-(4-butylcyclohexyl)butyl]cyclohexane |
|---|---|
| PubChem CID | 173281367 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | 1-[(E)-but-2-enyl]-4-[4-(4-butylcyclohexyl)butyl]cyclohexane |
| SMILES | C/C=C/CC1CCC(CCCCC2CCC(CCCC)CC2)CC1 |
| InChI | InChI=1S/C24H44/c1-3-5-9-21-13-17-23(18-14-21)11-7-8-12-24-19-15-22(16-20-24)10-6-4-2/h3,5,21-24H,4,6-20H2,1-2H3/b5-3+ |
| InChIKey | RABSFPQMLVXIKD-HWKANZROSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|