C21H38 — CID 125478979
1-[(E)-but-2-enyl]-4-(4-pentylcyclohexyl)cyclohexane (PubChem CID 125478979) has the molecular formula C21H38 and a molecular weight of 290.53 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-4-(4-pentylcyclohexyl)cyclohexane.
| Compound Name | 1-[(E)-but-2-enyl]-4-(4-pentylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 125478979 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 1-[(E)-but-2-enyl]-4-(4-pentylcyclohexyl)cyclohexane |
| SMILES | C/C=C/CC1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C21H38/c1-3-5-7-9-19-12-16-21(17-13-19)20-14-10-18(11-15-20)8-6-4-2/h4,6,18-21H,3,5,7-17H2,1-2H3/b6-4+ |
| InChIKey | LHZLGLNUBMZYLW-GQCTYLIASA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|