C20H36 — CID 20594578
1-pentyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane (PubChem CID 20594578) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 1-pentyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-pentyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 20594578 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 1-pentyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
| SMILES | C/C=C/C1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C20H36/c1-3-5-6-8-18-11-15-20(16-12-18)19-13-9-17(7-4-2)10-14-19/h4,7,17-20H,3,5-6,8-16H2,1-2H3/b7-4+ |
| InChIKey | ULZKWMBZCQZGMN-QPJJXVBHSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|