C30H52 — CID 19070151
1-(4-pentylcyclohexyl)-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexane (PubChem CID 19070151) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is 1-(4-pentylcyclohexyl)-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexane.
| Compound Name | 1-(4-pentylcyclohexyl)-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 19070151 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | 1-(4-pentylcyclohexyl)-4-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexane |
| SMILES | C/C=C/C1CCC(CC/C=C/C2CCC(C3CCC(CCCCC)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H52/c1-3-5-6-10-27-17-21-29(22-18-27)30-23-19-28(20-24-30)12-8-7-11-26-15-13-25(9-4-2)14-16-26/h4,8-9,12,25-30H,3,5-7,10-11,13-24H2,1-2H3/b9-4+,12-8+ |
| InChIKey | KSQRVESVLWPCKU-FMQHCKNKSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|