C24H41F3 — CID 139983585
1-heptyl-4-[4-[(E)-5,5,5-trifluoropent-1-enyl]cyclohexyl]cyclohexane (PubChem CID 139983585) has the molecular formula C24H41F3 and a molecular weight of 386.59 g/mol. Its IUPAC name is 1-heptyl-4-[4-[(E)-5,5,5-trifluoropent-1-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-heptyl-4-[4-[(E)-5,5,5-trifluoropent-1-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 139983585 |
| Molecular Formula | C24H41F3 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 1-heptyl-4-[4-[(E)-5,5,5-trifluoropent-1-enyl]cyclohexyl]cyclohexane |
| SMILES | CCCCCCCC1CCC(C2CCC(/C=C/CCC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C24H41F3/c1-2-3-4-5-6-9-20-11-15-22(16-12-20)23-17-13-21(14-18-23)10-7-8-19-24(25,26)27/h7,10,20-23H,2-6,8-9,11-19H2,1H3/b10-7+ |
| InChIKey | BEBSYSXNWUUZCY-JXMROGBWSA-N |
| XLogP | 8.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|