C20H35F — CID 19695446
1-[(E)-5-fluoropent-1-enyl]-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 19695446) has the molecular formula C20H35F and a molecular weight of 294.50 g/mol. Its IUPAC name is 1-[(E)-5-fluoropent-1-enyl]-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-[(E)-5-fluoropent-1-enyl]-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 19695446 |
| Molecular Formula | C20H35F |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 1-[(E)-5-fluoropent-1-enyl]-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC1CCC(C2CCC(/C=C/CCCF)CC2)CC1 |
| InChI | InChI=1S/C20H35F/c1-2-6-17-8-12-19(13-9-17)20-14-10-18(11-15-20)7-4-3-5-16-21/h4,7,17-20H,2-3,5-6,8-16H2,1H3/b7-4+ |
| InChIKey | JMXNFNOEGSXZTL-QPJJXVBHSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|