C18H31F — CID 70907603
1-(3-fluoropropyl)-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane (PubChem CID 70907603) has the molecular formula C18H31F and a molecular weight of 266.44 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-(3-fluoropropyl)-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 70907603 |
| Molecular Formula | C18H31F |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-(3-fluoropropyl)-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
| SMILES | C/C=C/C1CCC(C2CCC(CCCF)CC2)CC1 |
| InChI | InChI=1S/C18H31F/c1-2-4-15-6-10-17(11-7-15)18-12-8-16(9-13-18)5-3-14-19/h2,4,15-18H,3,5-14H2,1H3/b4-2+ |
| InChIKey | KNZBLEMYOJOUAC-DUXPYHPUSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|