C26H42 — CID 59431504
1-[(E)-prop-1-enyl]-4-[(E)-2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]ethenyl]cyclohexane (PubChem CID 59431504) has the molecular formula C26H42 and a molecular weight of 354.62 g/mol. Its IUPAC name is 1-[(E)-prop-1-enyl]-4-[(E)-2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]ethenyl]cyclohexane.
| Compound Name | 1-[(E)-prop-1-enyl]-4-[(E)-2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 59431504 |
| Molecular Formula | C26H42 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.33 |
| IUPAC Name | 1-[(E)-prop-1-enyl]-4-[(E)-2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]ethenyl]cyclohexane |
| SMILES | C/C=C/C1CCC(/C=C/C2CCC(C3CCC(/C=C/C)CC3)CC2)CC1 |
| InChI | InChI=1S/C26H42/c1-3-5-21-7-9-23(10-8-21)11-12-24-15-19-26(20-16-24)25-17-13-22(6-4-2)14-18-25/h3-6,11-12,21-26H,7-10,13-20H2,1-2H3/b5-3+,6-4+,12-11+ |
| InChIKey | SGWCJKDJCQCZRU-FGEFXVFKSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|