C17H32 — CID 159017755
methane;1-methyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane (PubChem CID 159017755) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is methane;1-methyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane.
| Compound Name | methane;1-methyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 159017755 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | methane;1-methyl-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
| SMILES | C.C/C=C/C1CCC(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C16H28.CH4/c1-3-4-14-7-11-16(12-8-14)15-9-5-13(2)6-10-15;/h3-4,13-16H,5-12H2,1-2H3;1H4/b4-3+; |
| InChIKey | JTHOMYDGMXNCHT-BJILWQEISA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|