C16H28S — CID 134454006
1-methyl-4-[4-(2-methylsulfanylethenyl)cyclohexyl]cyclohexane (PubChem CID 134454006) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is 1-methyl-4-[4-(2-methylsulfanylethenyl)cyclohexyl]cyclohexane.
| Compound Name | 1-methyl-4-[4-(2-methylsulfanylethenyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 134454006 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-methyl-4-[4-(2-methylsulfanylethenyl)cyclohexyl]cyclohexane |
| SMILES | CSC=CC1CCC(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C16H28S/c1-13-3-7-15(8-4-13)16-9-5-14(6-10-16)11-12-17-2/h11-16H,3-10H2,1-2H3 |
| InChIKey | VTSKFYULHHFCNJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |