C22H37N — CID 59916878
N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine (PubChem CID 59916878) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine.
| Compound Name | N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 59916878 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine |
| SMILES | C=NC1CCC(/C=C/C2CCC(C3CCC(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C22H37N/c1-17-3-11-20(12-4-17)21-13-7-18(8-14-21)5-6-19-9-15-22(23-2)16-10-19/h5-6,17-22H,2-4,7-16H2,1H3/b6-5+ |
| InChIKey | GZTSLCODKVQEKH-AATRIKPKSA-N |
| XLogP | 6.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|