C29H48O2 — CID 59938787
(4-methylcyclohexyl) 4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexane-1-carboxylate (PubChem CID 59938787) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (4-methylcyclohexyl) 4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexane-1-carboxylate.
| Compound Name | (4-methylcyclohexyl) 4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59938787 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (4-methylcyclohexyl) 4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexane-1-carboxylate |
| SMILES | CC1CCC(OC(=O)C2CCC(/C=C/C3CCC(C4CCC(C)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C29H48O2/c1-21-3-13-25(14-4-21)26-15-9-23(10-16-26)7-8-24-11-17-27(18-12-24)29(30)31-28-19-5-22(2)6-20-28/h7-8,21-28H,3-6,9-20H2,1-2H3/b8-7+ |
| InChIKey | JWIDRHHWZYPRBS-BQYQJAHWSA-N |
| XLogP | 8.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|