About CID 59881533
CID 59881533 (PubChem CID 59881533) has the molecular formula C23H39O2
and a molecular weight of 347.56 g/mol.
Molecular Properties
| Compound Name | CID 59881533 |
| PubChem CID | 59881533 |
| Molecular Formula | C23H39O2 |
| Molecular Weight | 347.56 g/mol |
| Exact Mass | 347.30 |
| IUPAC Name | — |
| SMILES | C[C]1C(C)CC(OC(=O)C2CCC(C3CCC(C)CC3)CC2)CC1C |
| InChI | InChI=1S/C23H39O2/c1-15-5-7-19(8-6-15)20-9-11-21(12-10-20)23(24)25-22-13-16(2)18(4)17(3)14-22/h15-17,19-22H,5-14H2,1-4H3 |
| InChIKey | ADUAYPJBHXMPJE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59881533 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59881533?
The IUPAC name of CID 59881533 (CID 59881533) is not available.
What is the SMILES notation for CID 59881533?
The canonical SMILES for CID 59881533 is C[C]1C(C)CC(OC(=O)C2CCC(C3CCC(C)CC3)CC2)CC1C.
What is the InChIKey of CID 59881533?
The InChIKey is ADUAYPJBHXMPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H39O2/c1-15-5-7-19(8-6-15)20-9-11-21(12-10-20)23(24)25-22-13-16(2)18(4)17(3)14-22/h15-17,19-22H,5-14H2,1-4H3.
What are the key properties of CID 59881533?
CID 59881533 has a molecular weight of 347.56 g/mol, XLogP of 6.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59881533 is sourced from PubChem (CID 59881533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).