About [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate
[2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 21359941) has the molecular formula C19H32O4
and a molecular weight of 324.46 g/mol. Its IUPAC name is [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate |
| PubChem CID | 21359941 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)OC2COC(C3CCC(C)CC3)OC2)CC1 |
| InChI | InChI=1S/C19H32O4/c1-13-3-7-15(8-4-13)18(20)23-17-11-21-19(22-12-17)16-9-5-14(2)6-10-16/h13-17,19H,3-12H2,1-2H3 |
| InChIKey | DDHBLOGRXLAKCP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate?
The IUPAC name of [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate (CID 21359941) is [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate?
The canonical SMILES for [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate is CC1CCC(C(=O)OC2COC(C3CCC(C)CC3)OC2)CC1.
What is the InChIKey of [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate?
The InChIKey is DDHBLOGRXLAKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O4/c1-13-3-7-15(8-4-13)18(20)23-17-11-21-19(22-12-17)16-9-5-14(2)6-10-16/h13-17,19H,3-12H2,1-2H3.
What are the key properties of [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate?
[2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate has a molecular weight of 324.46 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylcyclohexyl)-1,3-dioxan-5-yl] 4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 21359941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).