About 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen
1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen (PubChem CID 158561859) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen.
Molecular Properties
| Compound Name | 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen |
| PubChem CID | 158561859 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen |
| SMILES | CC1CCC(/C=C/C2CCC(C)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C16H28.2H2/c1-13-3-7-15(8-4-13)11-12-16-9-5-14(2)6-10-16;;/h11-16H,3-10H2,1-2H3;2*1H/b12-11+;; |
| InChIKey | HQZGQWHBBUFKFP-YHPRVSEPSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen?
The IUPAC name of 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen (CID 158561859) is 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen.
What is the SMILES notation for 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen?
The canonical SMILES for 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen is CC1CCC(/C=C/C2CCC(C)CC2)CC1.[H][H].[H][H].
What is the InChIKey of 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen?
The InChIKey is HQZGQWHBBUFKFP-YHPRVSEPSA-N. The full InChI is InChI=1S/C16H28.2H2/c1-13-3-7-15(8-4-13)11-12-16-9-5-14(2)6-10-16;;/h11-16H,3-10H2,1-2H3;2*1H/b12-11+;;.
What are the key properties of 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen?
1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen has a molecular weight of 224.43 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane;molecular hydrogen is sourced from PubChem (CID 158561859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).