C9H18 — CID 142076315
1-ethenyl-4-methylcyclohexane;molecular hydrogen (PubChem CID 142076315) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is 1-ethenyl-4-methylcyclohexane;molecular hydrogen.
| Compound Name | 1-ethenyl-4-methylcyclohexane;molecular hydrogen |
|---|---|
| PubChem CID | 142076315 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | 1-ethenyl-4-methylcyclohexane;molecular hydrogen |
| SMILES | C=CC1CCC(C)CC1.[H][H] |
| InChI | InChI=1S/C9H16.H2/c1-3-9-6-4-8(2)5-7-9;/h3,8-9H,1,4-7H2,2H3;1H |
| InChIKey | GKJWGKAFSZVUBU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|