About ethane;ethene;1-ethenyl-4-methylcyclohexane
ethane;ethene;1-ethenyl-4-methylcyclohexane (PubChem CID 142074855) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is ethane;ethene;1-ethenyl-4-methylcyclohexane.
Molecular Properties
| Compound Name | ethane;ethene;1-ethenyl-4-methylcyclohexane |
| PubChem CID | 142074855 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | ethane;ethene;1-ethenyl-4-methylcyclohexane |
| SMILES | C=C.C=CC1CCC(C)CC1.CC |
| InChI | InChI=1S/C9H16.C2H6.C2H4/c1-3-9-6-4-8(2)5-7-9;2*1-2/h3,8-9H,1,4-7H2,2H3;1-2H3;1-2H2 |
| InChIKey | KHFFVOBTXQOSDZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;1-ethenyl-4-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;1-ethenyl-4-methylcyclohexane?
The IUPAC name of ethane;ethene;1-ethenyl-4-methylcyclohexane (CID 142074855) is ethane;ethene;1-ethenyl-4-methylcyclohexane.
What is the SMILES notation for ethane;ethene;1-ethenyl-4-methylcyclohexane?
The canonical SMILES for ethane;ethene;1-ethenyl-4-methylcyclohexane is C=C.C=CC1CCC(C)CC1.CC.
What is the InChIKey of ethane;ethene;1-ethenyl-4-methylcyclohexane?
The InChIKey is KHFFVOBTXQOSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.C2H6.C2H4/c1-3-9-6-4-8(2)5-7-9;2*1-2/h3,8-9H,1,4-7H2,2H3;1-2H3;1-2H2.
What are the key properties of ethane;ethene;1-ethenyl-4-methylcyclohexane?
ethane;ethene;1-ethenyl-4-methylcyclohexane has a molecular weight of 182.35 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;1-ethenyl-4-methylcyclohexane is sourced from PubChem (CID 142074855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).