C10H24S — CID 142040311
1,4-dimethylcyclohexane;ethane;sulfane (PubChem CID 142040311) has the molecular formula C10H24S and a molecular weight of 176.37 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;ethane;sulfane.
| Compound Name | 1,4-dimethylcyclohexane;ethane;sulfane |
|---|---|
| PubChem CID | 142040311 |
| Molecular Formula | C10H24S |
| Molecular Weight | 176.37 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1,4-dimethylcyclohexane;ethane;sulfane |
| SMILES | CC.CC1CCC(C)CC1.S |
| InChI | InChI=1S/C8H16.C2H6.H2S/c1-7-3-5-8(2)6-4-7;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;1H2 |
| InChIKey | YTEOXSSDUCPWFT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |