C9H20O — CID 70358527
1,4-dimethylcyclohexane;methanol (PubChem CID 70358527) has the molecular formula C9H20O and a molecular weight of 144.26 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;methanol.
| Compound Name | 1,4-dimethylcyclohexane;methanol |
|---|---|
| PubChem CID | 70358527 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | 1,4-dimethylcyclohexane;methanol |
| SMILES | CC1CCC(C)CC1.CO |
| InChI | InChI=1S/C8H16.CH4O/c1-7-3-5-8(2)6-4-7;1-2/h7-8H,3-6H2,1-2H3;2H,1H3 |
| InChIKey | FIVPMCMJUUXANY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |