C14H28 — CID 123773414
1,2,3,4,7-pentamethylcyclononane (PubChem CID 123773414) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 1,2,3,4,7-pentamethylcyclononane.
| Compound Name | 1,2,3,4,7-pentamethylcyclononane |
|---|---|
| PubChem CID | 123773414 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 1,2,3,4,7-pentamethylcyclononane |
| SMILES | CC1CCC(C)C(C)C(C)C(C)CC1 |
| InChI | InChI=1S/C14H28/c1-10-6-8-11(2)13(4)14(5)12(3)9-7-10/h10-14H,6-9H2,1-5H3 |
| InChIKey | RKMKTFCUALKVNL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |