C16H36 — CID 178085066
ethane;1,2,3,6-tetramethylcyclooctane (PubChem CID 178085066) has the molecular formula C16H36 and a molecular weight of 228.46 g/mol. Its IUPAC name is ethane;1,2,3,6-tetramethylcyclooctane.
| Compound Name | ethane;1,2,3,6-tetramethylcyclooctane |
|---|---|
| PubChem CID | 178085066 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | ethane;1,2,3,6-tetramethylcyclooctane |
| SMILES | CC.CC.CC1CCC(C)C(C)C(C)CC1 |
| InChI | InChI=1S/C12H24.2C2H6/c1-9-5-7-10(2)12(4)11(3)8-6-9;2*1-2/h9-12H,5-8H2,1-4H3;2*1-2H3 |
| InChIKey | MRQONOARTHVBFN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |