C24H43N — CID 140571030
N-(2,4-dimethylcyclohexyl)-N-(4-ethenylcyclohexyl)-2,4-dimethylcyclohexan-1-amine (PubChem CID 140571030) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is N-(2,4-dimethylcyclohexyl)-N-(4-ethenylcyclohexyl)-2,4-dimethylcyclohexan-1-amine.
| Compound Name | N-(2,4-dimethylcyclohexyl)-N-(4-ethenylcyclohexyl)-2,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 140571030 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | N-(2,4-dimethylcyclohexyl)-N-(4-ethenylcyclohexyl)-2,4-dimethylcyclohexan-1-amine |
| SMILES | C=CC1CCC(N(C2CCC(C)CC2C)C2CCC(C)CC2C)CC1 |
| InChI | InChI=1S/C24H43N/c1-6-21-9-11-22(12-10-21)25(23-13-7-17(2)15-19(23)4)24-14-8-18(3)16-20(24)5/h6,17-24H,1,7-16H2,2-5H3 |
| InChIKey | JAFNLKIIEZNTMD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|