C12H24 — CID 143207581
1,3-dimethylcyclopentane;ethene;prop-1-ene (PubChem CID 143207581) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is 1,3-dimethylcyclopentane;ethene;prop-1-ene.
| Compound Name | 1,3-dimethylcyclopentane;ethene;prop-1-ene |
|---|---|
| PubChem CID | 143207581 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 1,3-dimethylcyclopentane;ethene;prop-1-ene |
| SMILES | C=C.C=CC.CC1CCC(C)C1 |
| InChI | InChI=1S/C7H14.C3H6.C2H4/c1-6-3-4-7(2)5-6;1-3-2;1-2/h6-7H,3-5H2,1-2H3;3H,1H2,2H3;1-2H2 |
| InChIKey | SAXCSZOYAXNGDC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|