4-ethenyl-1-methylpiperidine;molecular hydrogen

C8H17N — CID 143787743

IUPAC4-ethenyl-1-methylpiperidine;molecular hydrogen
SMILESC=CC1CCN(C)CC1.[H][H]
InChIInChI=1S/C8H15N.H2/c1-3-8-4-6-9(2)7-5-8;/h3,8H,1,4-7H2,2H3;1H
InChIKeyZWHQRAFSLRDLBN-UHFFFAOYSA-N
MW127.23 g/mol
LogP1.76
Rot. Bonds1

About 4-ethenyl-1-methylpiperidine;molecular hydrogen

4-ethenyl-1-methylpiperidine;molecular hydrogen (PubChem CID 143787743) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is 4-ethenyl-1-methylpiperidine;molecular hydrogen.

Molecular Properties

Compound Name4-ethenyl-1-methylpiperidine;molecular hydrogen
PubChem CID143787743
Molecular FormulaC8H17N
Molecular Weight127.23 g/mol
Exact Mass127.14
IUPAC Name4-ethenyl-1-methylpiperidine;molecular hydrogen
SMILESC=CC1CCN(C)CC1.[H][H]
InChIInChI=1S/C8H15N.H2/c1-3-8-4-6-9(2)7-5-8;/h3,8H,1,4-7H2,2H3;1H
InChIKeyZWHQRAFSLRDLBN-UHFFFAOYSA-N
XLogP1.76
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.23
LogP ≤ 51.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-ethenyl-1-methylpiperidine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethenyl-1-methylpiperidine;molecular hydrogen?
The IUPAC name of 4-ethenyl-1-methylpiperidine;molecular hydrogen (CID 143787743) is 4-ethenyl-1-methylpiperidine;molecular hydrogen.
What is the SMILES notation for 4-ethenyl-1-methylpiperidine;molecular hydrogen?
The canonical SMILES for 4-ethenyl-1-methylpiperidine;molecular hydrogen is C=CC1CCN(C)CC1.[H][H].
What is the InChIKey of 4-ethenyl-1-methylpiperidine;molecular hydrogen?
The InChIKey is ZWHQRAFSLRDLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.H2/c1-3-8-4-6-9(2)7-5-8;/h3,8H,1,4-7H2,2H3;1H.
What are the key properties of 4-ethenyl-1-methylpiperidine;molecular hydrogen?
4-ethenyl-1-methylpiperidine;molecular hydrogen has a molecular weight of 127.23 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1-methylpiperidine;molecular hydrogen is sourced from PubChem (CID 143787743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).