C22H41N3 — CID 176683518
1-ethenyl-4-prop-1-en-2-ylcyclohexane;1-methyl-4-(1-methylpiperidin-4-yl)piperazine (PubChem CID 176683518) has the molecular formula C22H41N3 and a molecular weight of 347.59 g/mol. Its IUPAC name is 1-ethenyl-4-prop-1-en-2-ylcyclohexane;1-methyl-4-(1-methylpiperidin-4-yl)piperazine.
| Compound Name | 1-ethenyl-4-prop-1-en-2-ylcyclohexane;1-methyl-4-(1-methylpiperidin-4-yl)piperazine |
|---|---|
| PubChem CID | 176683518 |
| Molecular Formula | C22H41N3 |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.33 |
| IUPAC Name | 1-ethenyl-4-prop-1-en-2-ylcyclohexane;1-methyl-4-(1-methylpiperidin-4-yl)piperazine |
| SMILES | C=CC1CCC(C(=C)C)CC1.CN1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C11H23N3.C11H18/c1-12-5-3-11(4-6-12)14-9-7-13(2)8-10-14;1-4-10-5-7-11(8-6-10)9(2)3/h11H,3-10H2,1-2H3;4,10-11H,1-2,5-8H2,3H3 |
| InChIKey | CFKNNDKPVKPLRG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|