C11H19N — CID 142926355
1-methyl-4-[(3E)-penta-1,3-dien-3-yl]piperidine (PubChem CID 142926355) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-methyl-4-[(3E)-penta-1,3-dien-3-yl]piperidine.
| Compound Name | 1-methyl-4-[(3E)-penta-1,3-dien-3-yl]piperidine |
|---|---|
| PubChem CID | 142926355 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-methyl-4-[(3E)-penta-1,3-dien-3-yl]piperidine |
| SMILES | C=C/C(=C\C)C1CCN(C)CC1 |
| InChI | InChI=1S/C11H19N/c1-4-10(5-2)11-6-8-12(3)9-7-11/h4-5,11H,1,6-9H2,2-3H3/b10-5+ |
| InChIKey | PRCCNPUMJANYOJ-BJMVGYQFSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|