C12H21N3 — CID 167039292
(2Z,4Z)-5-(methylideneamino)-4-(1-methylpiperidin-4-yl)penta-2,4-dien-1-amine (PubChem CID 167039292) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (2Z,4Z)-5-(methylideneamino)-4-(1-methylpiperidin-4-yl)penta-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-5-(methylideneamino)-4-(1-methylpiperidin-4-yl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 167039292 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (2Z,4Z)-5-(methylideneamino)-4-(1-methylpiperidin-4-yl)penta-2,4-dien-1-amine |
| SMILES | C=N/C=C(\C=C/CN)C1CCN(C)CC1 |
| InChI | InChI=1S/C12H21N3/c1-14-10-12(4-3-7-13)11-5-8-15(2)9-6-11/h3-4,10-11H,1,5-9,13H2,2H3/b4-3-,12-10+ |
| InChIKey | VYRGFCRCOIWCNN-BJQBXBTNSA-N |
| XLogP | 1.43 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|