C13H22ClN3 — CID 142969803
acetylene;(2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine (PubChem CID 142969803) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is acetylene;(2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine.
| Compound Name | acetylene;(2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142969803 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | acetylene;(2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine |
| SMILES | C#C.C/C(Cl)=C(\C=C/CN)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20ClN3.C2H2/c1-10(12)11(4-3-5-13)15-8-6-14(2)7-9-15;1-2/h3-4H,5-9,13H2,1-2H3;1-2H/b4-3-,11-10-; |
| InChIKey | QBSGKNKFHXSMIB-VEVJROGOSA-N |
| XLogP | 1.47 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|