C10H22N2O — CID 142979179
ethane;1-(4-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 142979179) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;1-(4-methyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | ethane;1-(4-methyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 142979179 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | ethane;1-(4-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CC.CC(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C8H16N2O.C2H6/c1-8(11)10-5-3-4-9(2)6-7-10;1-2/h3-7H2,1-2H3;1-2H3 |
| InChIKey | AXMLCQXZVILWGC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |