C9H19N3O — CID 28745499
(2S)-2-amino-1-(4-methyl-1,4-diazepan-1-yl)propan-1-one (PubChem CID 28745499) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (2S)-2-amino-1-(4-methyl-1,4-diazepan-1-yl)propan-1-one.
| Compound Name | (2S)-2-amino-1-(4-methyl-1,4-diazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 28745499 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (2S)-2-amino-1-(4-methyl-1,4-diazepan-1-yl)propan-1-one |
| SMILES | C[C@H](N)C(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-8(10)9(13)12-5-3-4-11(2)6-7-12/h8H,3-7,10H2,1-2H3/t8-/m0/s1 |
| InChIKey | RJZKUNQHYCIFCL-QMMMGPOBSA-N |
| XLogP | -0.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |