C10H21N3O — CID 83635043
2-amino-1-(4-ethyl-1,4-diazepan-1-yl)propan-1-one (PubChem CID 83635043) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-amino-1-(4-ethyl-1,4-diazepan-1-yl)propan-1-one.
| Compound Name | 2-amino-1-(4-ethyl-1,4-diazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 83635043 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-amino-1-(4-ethyl-1,4-diazepan-1-yl)propan-1-one |
| SMILES | CCN1CCCN(C(=O)C(C)N)CC1 |
| InChI | InChI=1S/C10H21N3O/c1-3-12-5-4-6-13(8-7-12)10(14)9(2)11/h9H,3-8,11H2,1-2H3 |
| InChIKey | KCUOBULAZRIFJZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |