C11H22N2OS — CID 107021855
3-methyl-1-(4-methyl-1,4-diazepan-1-yl)-2-sulfanylbutan-1-one (PubChem CID 107021855) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 3-methyl-1-(4-methyl-1,4-diazepan-1-yl)-2-sulfanylbutan-1-one.
| Compound Name | 3-methyl-1-(4-methyl-1,4-diazepan-1-yl)-2-sulfanylbutan-1-one |
|---|---|
| PubChem CID | 107021855 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-methyl-1-(4-methyl-1,4-diazepan-1-yl)-2-sulfanylbutan-1-one |
| SMILES | CC(C)C(S)C(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C11H22N2OS/c1-9(2)10(15)11(14)13-6-4-5-12(3)7-8-13/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | PGYICHMSGCTOAP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|