C9H17NO2S2 — CID 107025927
3-methyl-1-(1-oxo-1,4-thiazinan-4-yl)-2-sulfanylbutan-1-one (PubChem CID 107025927) has the molecular formula C9H17NO2S2 and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-methyl-1-(1-oxo-1,4-thiazinan-4-yl)-2-sulfanylbutan-1-one.
| Compound Name | 3-methyl-1-(1-oxo-1,4-thiazinan-4-yl)-2-sulfanylbutan-1-one |
|---|---|
| PubChem CID | 107025927 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-methyl-1-(1-oxo-1,4-thiazinan-4-yl)-2-sulfanylbutan-1-one |
| SMILES | CC(C)C(S)C(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C9H17NO2S2/c1-7(2)8(13)9(11)10-3-5-14(12)6-4-10/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | VIEMCRRVVWWALT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|