C8H15NO — CID 126991389
1-(aziridin-1-yl)-2,3-dimethylbutan-1-one (PubChem CID 126991389) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-(aziridin-1-yl)-2,3-dimethylbutan-1-one.
| Compound Name | 1-(aziridin-1-yl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 126991389 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-(aziridin-1-yl)-2,3-dimethylbutan-1-one |
| SMILES | CC(C)C(C)C(=O)N1CC1 |
| InChI | InChI=1S/C8H15NO/c1-6(2)7(3)8(10)9-4-5-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | JPDRSBIYOIJINB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|