C10H19N3O3 — CID 141387551
4-[(2S)-2-amino-3-methylbutanoyl]piperazine-1-carboxylic acid (PubChem CID 141387551) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-methylbutanoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(2S)-2-amino-3-methylbutanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141387551 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 4-[(2S)-2-amino-3-methylbutanoyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C10H19N3O3/c1-7(2)8(11)9(14)12-3-5-13(6-4-12)10(15)16/h7-8H,3-6,11H2,1-2H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | AHQPDJIAGLGRKM-QMMMGPOBSA-N |
| XLogP | -0.21 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |