C13H26N4O2 — CID 54872708
2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 54872708) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 54872708 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)C(N)C(=O)N1CCN(C(=O)CN(C)C)CC1 |
| InChI | InChI=1S/C13H26N4O2/c1-10(2)12(14)13(19)17-7-5-16(6-8-17)11(18)9-15(3)4/h10,12H,5-9,14H2,1-4H3 |
| InChIKey | KVWVQBUTYWMMJD-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |