C13H26N4O2S — CID 61165122
(2S)-2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 61165122) has the molecular formula C13H26N4O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2S)-2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 61165122 |
| Molecular Formula | C13H26N4O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (2S)-2-amino-1-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCN(C(=O)CN(C)C)CC1 |
| InChI | InChI=1S/C13H26N4O2S/c1-15(2)10-12(18)16-5-7-17(8-6-16)13(19)11(14)4-9-20-3/h11H,4-10,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | BPZFQJGOMLROFP-NSHDSACASA-N |
| XLogP | -0.70 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |