C15H29N3OS — CID 104907907
(2R)-2-amino-4-methylsulfanyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]butan-1-one (PubChem CID 104907907) has the molecular formula C15H29N3OS and a molecular weight of 299.48 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]butan-1-one.
| Compound Name | (2R)-2-amino-4-methylsulfanyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 104907907 |
| Molecular Formula | C15H29N3OS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]butan-1-one |
| SMILES | CSCC[C@@H](N)C(=O)N1CCC(CN2CCCC2)CC1 |
| InChI | InChI=1S/C15H29N3OS/c1-20-11-6-14(16)15(19)18-9-4-13(5-10-18)12-17-7-2-3-8-17/h13-14H,2-12,16H2,1H3/t14-/m1/s1 |
| InChIKey | NARLYFXIXBMQSC-CQSZACIVSA-N |
| XLogP | 1.40 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |