C16H33N3OS — CID 104907905
(2R)-2-amino-1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 104907905) has the molecular formula C16H33N3OS and a molecular weight of 315.53 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2R)-2-amino-1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 104907905 |
| Molecular Formula | C16H33N3OS |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (2R)-2-amino-1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CCCCN(C)CC1CCN(C(=O)[C@H](N)CCSC)CC1 |
| InChI | InChI=1S/C16H33N3OS/c1-4-5-9-18(2)13-14-6-10-19(11-7-14)16(20)15(17)8-12-21-3/h14-15H,4-13,17H2,1-3H3/t15-/m1/s1 |
| InChIKey | MFQSKBLFWZIBOY-OAHLLOKOSA-N |
| XLogP | 2.04 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |