C14H27N3O2S — CID 61163866
(2S)-2-amino-4-methylsulfanyl-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]butan-1-one (PubChem CID 61163866) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]butan-1-one.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 61163866 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]butan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C14H27N3O2S/c1-20-10-4-13(15)14(18)17-7-5-16(6-8-17)11-12-3-2-9-19-12/h12-13H,2-11,15H2,1H3/t12?,13-/m0/s1 |
| InChIKey | VWLKHLXWOLOXNX-ABLWVSNPSA-N |
| XLogP | 0.39 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |