C13H23BrN2O2 — CID 114014436
2-bromo-1-[4-(oxolan-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 114014436) has the molecular formula C13H23BrN2O2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 2-bromo-1-[4-(oxolan-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 2-bromo-1-[4-(oxolan-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 114014436 |
| Molecular Formula | C13H23BrN2O2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-bromo-1-[4-(oxolan-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CC(Br)C(=O)N1CCCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C13H23BrN2O2/c1-11(14)13(17)16-6-3-5-15(7-8-16)10-12-4-2-9-18-12/h11-12H,2-10H2,1H3 |
| InChIKey | ODLXSHWESKUKDM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|