C13H24N2O3S — CID 119344999
(2S)-2-amino-4-methylsulfanyl-1-[2-(oxolan-2-yl)morpholin-4-yl]butan-1-one (PubChem CID 119344999) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-1-[2-(oxolan-2-yl)morpholin-4-yl]butan-1-one.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-1-[2-(oxolan-2-yl)morpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 119344999 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-1-[2-(oxolan-2-yl)morpholin-4-yl]butan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCOC(C2CCCO2)C1 |
| InChI | InChI=1S/C13H24N2O3S/c1-19-8-4-10(14)13(16)15-5-7-18-12(9-15)11-3-2-6-17-11/h10-12H,2-9,14H2,1H3/t10-,11?,12?/m0/s1 |
| InChIKey | LBCOABMICYISHO-UNXYVOJBSA-N |
| XLogP | 0.47 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |