C17H32N2O2S — CID 119321396
(2S)-2-amino-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 119321396) has the molecular formula C17H32N2O2S and a molecular weight of 328.52 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2S)-2-amino-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 119321396 |
| Molecular Formula | C17H32N2O2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2S)-2-amino-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCC(OC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C17H32N2O2S/c1-13-3-5-14(6-4-13)21-15-7-10-19(11-8-15)17(20)16(18)9-12-22-2/h13-16H,3-12,18H2,1-2H3/t13?,14?,16-/m0/s1 |
| InChIKey | YSSLQHGQUDPADA-XUJLQICISA-N |
| XLogP | 2.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |