C12H24N4O2S — CID 104907641
4-[(2R)-2-amino-4-methylsulfanylbutanoyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 104907641) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-[(2R)-2-amino-4-methylsulfanylbutanoyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[(2R)-2-amino-4-methylsulfanylbutanoyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 104907641 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-[(2R)-2-amino-4-methylsulfanylbutanoyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)[C@H](N)CCSC)CC1 |
| InChI | InChI=1S/C12H24N4O2S/c1-3-14-12(18)16-7-5-15(6-8-16)11(17)10(13)4-9-19-2/h10H,3-9,13H2,1-2H3,(H,14,18)/t10-/m1/s1 |
| InChIKey | SPINOHOTOPPRAY-SNVBAGLBSA-N |
| XLogP | -0.06 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |