C10H19N3O2S — CID 76981850
1-(2-amino-4-methylsulfanylbutanoyl)-1,4-diazepan-5-one (PubChem CID 76981850) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 1-(2-amino-4-methylsulfanylbutanoyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-amino-4-methylsulfanylbutanoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 76981850 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(2-amino-4-methylsulfanylbutanoyl)-1,4-diazepan-5-one |
| SMILES | CSCCC(N)C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C10H19N3O2S/c1-16-7-3-8(11)10(15)13-5-2-9(14)12-4-6-13/h8H,2-7,11H2,1H3,(H,12,14) |
| InChIKey | CRGOUHZZWNFIGS-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |