C11H23N3O2S — CID 104906961
(2R)-2-amino-1-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 104906961) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2R)-2-amino-1-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 104906961 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (2R)-2-amino-1-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CSCC[C@@H](N)C(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C11H23N3O2S/c1-17-9-2-10(12)11(16)14-5-3-13(4-6-14)7-8-15/h10,15H,2-9,12H2,1H3/t10-/m1/s1 |
| InChIKey | BPFHFDOWALEQKL-SNVBAGLBSA-N |
| XLogP | -0.80 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |