C13H25NO2 — CID 107406135
1-(4-hydroxy-4-methylazepan-1-yl)-2,3-dimethylbutan-1-one (PubChem CID 107406135) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(4-hydroxy-4-methylazepan-1-yl)-2,3-dimethylbutan-1-one.
| Compound Name | 1-(4-hydroxy-4-methylazepan-1-yl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 107406135 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1-(4-hydroxy-4-methylazepan-1-yl)-2,3-dimethylbutan-1-one |
| SMILES | CC(C)C(C)C(=O)N1CCCC(C)(O)CC1 |
| InChI | InChI=1S/C13H25NO2/c1-10(2)11(3)12(15)14-8-5-6-13(4,16)7-9-14/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | KUJVLTATFBSPPO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |