1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid

C10H17NO4 — CID 154842925

IUPAC1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid
SMILESCC(C)C(C)C(=O)N1CC(O)(C(=O)O)C1
InChIInChI=1S/C10H17NO4/c1-6(2)7(3)8(12)11-4-10(15,5-11)9(13)14/h6-7,15H,4-5H2,1-3H3,(H,13,14)
InChIKeyCGZBRVNFTDARPO-UHFFFAOYSA-N
MW215.25 g/mol
LogP-0.06
Rot. Bonds3

About 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid

1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid (PubChem CID 154842925) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid
PubChem CID154842925
Molecular FormulaC10H17NO4
Molecular Weight215.25 g/mol
Exact Mass215.12
IUPAC Name1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid
SMILESCC(C)C(C)C(=O)N1CC(O)(C(=O)O)C1
InChIInChI=1S/C10H17NO4/c1-6(2)7(3)8(12)11-4-10(15,5-11)9(13)14/h6-7,15H,4-5H2,1-3H3,(H,13,14)
InChIKeyCGZBRVNFTDARPO-UHFFFAOYSA-N
XLogP-0.06
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 5-0.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid?
The IUPAC name of 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid (CID 154842925) is 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid?
The canonical SMILES for 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid is CC(C)C(C)C(=O)N1CC(O)(C(=O)O)C1.
What is the InChIKey of 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid?
The InChIKey is CGZBRVNFTDARPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-6(2)7(3)8(12)11-4-10(15,5-11)9(13)14/h6-7,15H,4-5H2,1-3H3,(H,13,14).
What are the key properties of 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid?
1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid has a molecular weight of 215.25 g/mol, XLogP of -0.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylbutanoyl)-3-hydroxyazetidine-3-carboxylic acid is sourced from PubChem (CID 154842925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).