C9H18N2O2 — CID 107220086
(2S)-2-amino-1-(3-hydroxy-3-propan-2-ylazetidin-1-yl)propan-1-one (PubChem CID 107220086) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S)-2-amino-1-(3-hydroxy-3-propan-2-ylazetidin-1-yl)propan-1-one.
| Compound Name | (2S)-2-amino-1-(3-hydroxy-3-propan-2-ylazetidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 107220086 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2S)-2-amino-1-(3-hydroxy-3-propan-2-ylazetidin-1-yl)propan-1-one |
| SMILES | CC(C)C1(O)CN(C(=O)[C@H](C)N)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-6(2)9(13)4-11(5-9)8(12)7(3)10/h6-7,13H,4-5,10H2,1-3H3/t7-/m0/s1 |
| InChIKey | LMHVQXYPBROYLK-ZETCQYMHSA-N |
| XLogP | -0.44 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |