C11H22N2O2 — CID 102743719
2-amino-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-one (PubChem CID 102743719) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-one.
| Compound Name | 2-amino-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 102743719 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-amino-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-one |
| SMILES | CC(N)C(=O)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-8(12)9(14)13-6-10(2,3)15-11(4,5)7-13/h8H,6-7,12H2,1-5H3 |
| InChIKey | PQWUVCUZESVGIB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |